About 2-sulfanylidene-1-(2,3,5-trifluorophenyl)pyrimidin-4-one
2-sulfanylidene-1-(2,3,5-trifluorophenyl)pyrimidin-4-one (PubChem CID 62813465) has the molecular formula C10H5F3N2OS
and a molecular weight of 258.22 g/mol. Its IUPAC name is 2-sulfanylidene-1-(2,3,5-trifluorophenyl)pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-sulfanylidene-1-(2,3,5-trifluorophenyl)pyrimidin-4-one |
| PubChem CID | 62813465 |
| Molecular Formula | C10H5F3N2OS |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 2-sulfanylidene-1-(2,3,5-trifluorophenyl)pyrimidin-4-one |
| SMILES | O=c1ccn(-c2cc(F)cc(F)c2F)c(=S)[nH]1 |
| InChI | InChI=1S/C10H5F3N2OS/c11-5-3-6(12)9(13)7(4-5)15-2-1-8(16)14-10(15)17/h1-4H,(H,14,16,17) |
| InChIKey | XPSKEVFWEVKEGE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylidene-1-(2,3,5-trifluorophenyl)pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylidene-1-(2,3,5-trifluorophenyl)pyrimidin-4-one?
The IUPAC name of 2-sulfanylidene-1-(2,3,5-trifluorophenyl)pyrimidin-4-one (CID 62813465) is 2-sulfanylidene-1-(2,3,5-trifluorophenyl)pyrimidin-4-one.
What is the SMILES notation for 2-sulfanylidene-1-(2,3,5-trifluorophenyl)pyrimidin-4-one?
The canonical SMILES for 2-sulfanylidene-1-(2,3,5-trifluorophenyl)pyrimidin-4-one is O=c1ccn(-c2cc(F)cc(F)c2F)c(=S)[nH]1.
What is the InChIKey of 2-sulfanylidene-1-(2,3,5-trifluorophenyl)pyrimidin-4-one?
The InChIKey is XPSKEVFWEVKEGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F3N2OS/c11-5-3-6(12)9(13)7(4-5)15-2-1-8(16)14-10(15)17/h1-4H,(H,14,16,17).
What are the key properties of 2-sulfanylidene-1-(2,3,5-trifluorophenyl)pyrimidin-4-one?
2-sulfanylidene-1-(2,3,5-trifluorophenyl)pyrimidin-4-one has a molecular weight of 258.22 g/mol, XLogP of 2.31, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylidene-1-(2,3,5-trifluorophenyl)pyrimidin-4-one is sourced from PubChem (CID 62813465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).