C13H7F3N4S — CID 62814050
3-pyridin-3-yl-4-(2,3,5-trifluorophenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 62814050) has the molecular formula C13H7F3N4S and a molecular weight of 308.29 g/mol. Its IUPAC name is 3-pyridin-3-yl-4-(2,3,5-trifluorophenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-pyridin-3-yl-4-(2,3,5-trifluorophenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 62814050 |
| Molecular Formula | C13H7F3N4S |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 3-pyridin-3-yl-4-(2,3,5-trifluorophenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Fc1cc(F)c(F)c(-n2c(-c3cccnc3)n[nH]c2=S)c1 |
| InChI | InChI=1S/C13H7F3N4S/c14-8-4-9(15)11(16)10(5-8)20-12(18-19-13(20)21)7-2-1-3-17-6-7/h1-6H,(H,19,21) |
| InChIKey | ZUZCDUIBALIDBE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|