About 5-[2-(1-adamantyl)pyrimidin-4-yl]-2,4-dimethyl-1,3-oxazole
5-[2-(1-adamantyl)pyrimidin-4-yl]-2,4-dimethyl-1,3-oxazole (PubChem CID 628141) has the molecular formula C19H23N3O
and a molecular weight of 309.41 g/mol. Its IUPAC name is 5-[2-(1-adamantyl)pyrimidin-4-yl]-2,4-dimethyl-1,3-oxazole.
Molecular Properties
| Compound Name | 5-[2-(1-adamantyl)pyrimidin-4-yl]-2,4-dimethyl-1,3-oxazole |
| PubChem CID | 628141 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 5-[2-(1-adamantyl)pyrimidin-4-yl]-2,4-dimethyl-1,3-oxazole |
| SMILES | Cc1nc(C)c(-c2ccnc(C34CC5CC(CC(C5)C3)C4)n2)o1 |
| InChI | InChI=1S/C19H23N3O/c1-11-17(23-12(2)21-11)16-3-4-20-18(22-16)19-8-13-5-14(9-19)7-15(6-13)10-19/h3-4,13-15H,5-10H2,1-2H3 |
| InChIKey | BIRYFGPAKWWFBU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[2-(1-adamantyl)pyrimidin-4-yl]-2,4-dimethyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(1-adamantyl)pyrimidin-4-yl]-2,4-dimethyl-1,3-oxazole?
The IUPAC name of 5-[2-(1-adamantyl)pyrimidin-4-yl]-2,4-dimethyl-1,3-oxazole (CID 628141) is 5-[2-(1-adamantyl)pyrimidin-4-yl]-2,4-dimethyl-1,3-oxazole.
What is the SMILES notation for 5-[2-(1-adamantyl)pyrimidin-4-yl]-2,4-dimethyl-1,3-oxazole?
The canonical SMILES for 5-[2-(1-adamantyl)pyrimidin-4-yl]-2,4-dimethyl-1,3-oxazole is Cc1nc(C)c(-c2ccnc(C34CC5CC(CC(C5)C3)C4)n2)o1.
What is the InChIKey of 5-[2-(1-adamantyl)pyrimidin-4-yl]-2,4-dimethyl-1,3-oxazole?
The InChIKey is BIRYFGPAKWWFBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O/c1-11-17(23-12(2)21-11)16-3-4-20-18(22-16)19-8-13-5-14(9-19)7-15(6-13)10-19/h3-4,13-15H,5-10H2,1-2H3.
What are the key properties of 5-[2-(1-adamantyl)pyrimidin-4-yl]-2,4-dimethyl-1,3-oxazole?
5-[2-(1-adamantyl)pyrimidin-4-yl]-2,4-dimethyl-1,3-oxazole has a molecular weight of 309.41 g/mol, XLogP of 4.22, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(1-adamantyl)pyrimidin-4-yl]-2,4-dimethyl-1,3-oxazole is sourced from PubChem (CID 628141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).