About 4-chloro-3-ethyl-5,7,8-trifluoro-2-methylquinoline
4-chloro-3-ethyl-5,7,8-trifluoro-2-methylquinoline (PubChem CID 62814106) has the molecular formula C12H9ClF3N
and a molecular weight of 259.66 g/mol. Its IUPAC name is 4-chloro-3-ethyl-5,7,8-trifluoro-2-methylquinoline.
Molecular Properties
| Compound Name | 4-chloro-3-ethyl-5,7,8-trifluoro-2-methylquinoline |
| PubChem CID | 62814106 |
| Molecular Formula | C12H9ClF3N |
| Molecular Weight | 259.66 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 4-chloro-3-ethyl-5,7,8-trifluoro-2-methylquinoline |
| SMILES | CCc1c(C)nc2c(F)c(F)cc(F)c2c1Cl |
| InChI | InChI=1S/C12H9ClF3N/c1-3-6-5(2)17-12-9(10(6)13)7(14)4-8(15)11(12)16/h4H,3H2,1-2H3 |
| InChIKey | OUZGEVOIBNEEJQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.66 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-ethyl-5,7,8-trifluoro-2-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-ethyl-5,7,8-trifluoro-2-methylquinoline?
The IUPAC name of 4-chloro-3-ethyl-5,7,8-trifluoro-2-methylquinoline (CID 62814106) is 4-chloro-3-ethyl-5,7,8-trifluoro-2-methylquinoline.
What is the SMILES notation for 4-chloro-3-ethyl-5,7,8-trifluoro-2-methylquinoline?
The canonical SMILES for 4-chloro-3-ethyl-5,7,8-trifluoro-2-methylquinoline is CCc1c(C)nc2c(F)c(F)cc(F)c2c1Cl.
What is the InChIKey of 4-chloro-3-ethyl-5,7,8-trifluoro-2-methylquinoline?
The InChIKey is OUZGEVOIBNEEJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClF3N/c1-3-6-5(2)17-12-9(10(6)13)7(14)4-8(15)11(12)16/h4H,3H2,1-2H3.
What are the key properties of 4-chloro-3-ethyl-5,7,8-trifluoro-2-methylquinoline?
4-chloro-3-ethyl-5,7,8-trifluoro-2-methylquinoline has a molecular weight of 259.66 g/mol, XLogP of 4.18, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-ethyl-5,7,8-trifluoro-2-methylquinoline is sourced from PubChem (CID 62814106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).