C14H19F3N2 — CID 62814118
4-ethyl-1-(2,3,5-trifluorophenyl)-1,5-diazocane (PubChem CID 62814118) has the molecular formula C14H19F3N2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 4-ethyl-1-(2,3,5-trifluorophenyl)-1,5-diazocane.
| Compound Name | 4-ethyl-1-(2,3,5-trifluorophenyl)-1,5-diazocane |
|---|---|
| PubChem CID | 62814118 |
| Molecular Formula | C14H19F3N2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 4-ethyl-1-(2,3,5-trifluorophenyl)-1,5-diazocane |
| SMILES | CCC1CCN(c2cc(F)cc(F)c2F)CCCN1 |
| InChI | InChI=1S/C14H19F3N2/c1-2-11-4-7-19(6-3-5-18-11)13-9-10(15)8-12(16)14(13)17/h8-9,11,18H,2-7H2,1H3 |
| InChIKey | CISPRTWALDSVIZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|