About 4-(chloromethyl)-1-(2,3,5-trifluorophenyl)triazole
4-(chloromethyl)-1-(2,3,5-trifluorophenyl)triazole (PubChem CID 62814135) has the molecular formula C9H5ClF3N3
and a molecular weight of 247.61 g/mol. Its IUPAC name is 4-(chloromethyl)-1-(2,3,5-trifluorophenyl)triazole.
Molecular Properties
| Compound Name | 4-(chloromethyl)-1-(2,3,5-trifluorophenyl)triazole |
| PubChem CID | 62814135 |
| Molecular Formula | C9H5ClF3N3 |
| Molecular Weight | 247.61 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | 4-(chloromethyl)-1-(2,3,5-trifluorophenyl)triazole |
| SMILES | Fc1cc(F)c(F)c(-n2cc(CCl)nn2)c1 |
| InChI | InChI=1S/C9H5ClF3N3/c10-3-6-4-16(15-14-6)8-2-5(11)1-7(12)9(8)13/h1-2,4H,3H2 |
| InChIKey | FYBPQHNYVDBHQU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.61 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-1-(2,3,5-trifluorophenyl)triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-1-(2,3,5-trifluorophenyl)triazole?
The IUPAC name of 4-(chloromethyl)-1-(2,3,5-trifluorophenyl)triazole (CID 62814135) is 4-(chloromethyl)-1-(2,3,5-trifluorophenyl)triazole.
What is the SMILES notation for 4-(chloromethyl)-1-(2,3,5-trifluorophenyl)triazole?
The canonical SMILES for 4-(chloromethyl)-1-(2,3,5-trifluorophenyl)triazole is Fc1cc(F)c(F)c(-n2cc(CCl)nn2)c1.
What is the InChIKey of 4-(chloromethyl)-1-(2,3,5-trifluorophenyl)triazole?
The InChIKey is FYBPQHNYVDBHQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClF3N3/c10-3-6-4-16(15-14-6)8-2-5(11)1-7(12)9(8)13/h1-2,4H,3H2.
What are the key properties of 4-(chloromethyl)-1-(2,3,5-trifluorophenyl)triazole?
4-(chloromethyl)-1-(2,3,5-trifluorophenyl)triazole has a molecular weight of 247.61 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-1-(2,3,5-trifluorophenyl)triazole is sourced from PubChem (CID 62814135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).