C10H5ClF3N3 — CID 62814283
2-chloro-N-(3,4,5-trifluorophenyl)pyrimidin-4-amine (PubChem CID 62814283) has the molecular formula C10H5ClF3N3 and a molecular weight of 259.62 g/mol. Its IUPAC name is 2-chloro-N-(3,4,5-trifluorophenyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(3,4,5-trifluorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 62814283 |
| Molecular Formula | C10H5ClF3N3 |
| Molecular Weight | 259.62 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | 2-chloro-N-(3,4,5-trifluorophenyl)pyrimidin-4-amine |
| SMILES | Fc1cc(Nc2ccnc(Cl)n2)cc(F)c1F |
| InChI | InChI=1S/C10H5ClF3N3/c11-10-15-2-1-8(17-10)16-5-3-6(12)9(14)7(13)4-5/h1-4H,(H,15,16,17) |
| InChIKey | JXIJFLBMUVJAKK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.62 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|