C12H8F4N2 — CID 62814503
5-fluoro-3-N-(2,4,5-trifluorophenyl)benzene-1,3-diamine (PubChem CID 62814503) has the molecular formula C12H8F4N2 and a molecular weight of 256.20 g/mol. Its IUPAC name is 5-fluoro-3-N-(2,4,5-trifluorophenyl)benzene-1,3-diamine.
| Compound Name | 5-fluoro-3-N-(2,4,5-trifluorophenyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 62814503 |
| Molecular Formula | C12H8F4N2 |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 5-fluoro-3-N-(2,4,5-trifluorophenyl)benzene-1,3-diamine |
| SMILES | Nc1cc(F)cc(Nc2cc(F)c(F)cc2F)c1 |
| InChI | InChI=1S/C12H8F4N2/c13-6-1-7(17)3-8(2-6)18-12-5-10(15)9(14)4-11(12)16/h1-5,18H,17H2 |
| InChIKey | HNGOJEFNSJYLRP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|