About N-(3-phenylpropyl)-2,1-benzothiazol-3-amine
N-(3-phenylpropyl)-2,1-benzothiazol-3-amine (PubChem CID 62814643) has the molecular formula C16H16N2S
and a molecular weight of 268.39 g/mol. Its IUPAC name is N-(3-phenylpropyl)-2,1-benzothiazol-3-amine.
Molecular Properties
| Compound Name | N-(3-phenylpropyl)-2,1-benzothiazol-3-amine |
| PubChem CID | 62814643 |
| Molecular Formula | C16H16N2S |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N-(3-phenylpropyl)-2,1-benzothiazol-3-amine |
| SMILES | c1ccc(CCCNc2snc3ccccc23)cc1 |
| InChI | InChI=1S/C16H16N2S/c1-2-7-13(8-3-1)9-6-12-17-16-14-10-4-5-11-15(14)18-19-16/h1-5,7-8,10-11,17H,6,9,12H2 |
| InChIKey | OGAPXPVAGBARFM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-phenylpropyl)-2,1-benzothiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-phenylpropyl)-2,1-benzothiazol-3-amine?
The IUPAC name of N-(3-phenylpropyl)-2,1-benzothiazol-3-amine (CID 62814643) is N-(3-phenylpropyl)-2,1-benzothiazol-3-amine.
What is the SMILES notation for N-(3-phenylpropyl)-2,1-benzothiazol-3-amine?
The canonical SMILES for N-(3-phenylpropyl)-2,1-benzothiazol-3-amine is c1ccc(CCCNc2snc3ccccc23)cc1.
What is the InChIKey of N-(3-phenylpropyl)-2,1-benzothiazol-3-amine?
The InChIKey is OGAPXPVAGBARFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2S/c1-2-7-13(8-3-1)9-6-12-17-16-14-10-4-5-11-15(14)18-19-16/h1-5,7-8,10-11,17H,6,9,12H2.
What are the key properties of N-(3-phenylpropyl)-2,1-benzothiazol-3-amine?
N-(3-phenylpropyl)-2,1-benzothiazol-3-amine has a molecular weight of 268.39 g/mol, XLogP of 4.34, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-phenylpropyl)-2,1-benzothiazol-3-amine is sourced from PubChem (CID 62814643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).