About N-(4-methylcyclohexyl)-2,1-benzothiazol-3-amine
N-(4-methylcyclohexyl)-2,1-benzothiazol-3-amine (PubChem CID 62815339) has the molecular formula C14H18N2S
and a molecular weight of 246.38 g/mol. Its IUPAC name is N-(4-methylcyclohexyl)-2,1-benzothiazol-3-amine.
Molecular Properties
| Compound Name | N-(4-methylcyclohexyl)-2,1-benzothiazol-3-amine |
| PubChem CID | 62815339 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-(4-methylcyclohexyl)-2,1-benzothiazol-3-amine |
| SMILES | CC1CCC(Nc2snc3ccccc23)CC1 |
| InChI | InChI=1S/C14H18N2S/c1-10-6-8-11(9-7-10)15-14-12-4-2-3-5-13(12)16-17-14/h2-5,10-11,15H,6-9H2,1H3 |
| InChIKey | AQGJCCSSWBDPCH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-methylcyclohexyl)-2,1-benzothiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methylcyclohexyl)-2,1-benzothiazol-3-amine?
The IUPAC name of N-(4-methylcyclohexyl)-2,1-benzothiazol-3-amine (CID 62815339) is N-(4-methylcyclohexyl)-2,1-benzothiazol-3-amine.
What is the SMILES notation for N-(4-methylcyclohexyl)-2,1-benzothiazol-3-amine?
The canonical SMILES for N-(4-methylcyclohexyl)-2,1-benzothiazol-3-amine is CC1CCC(Nc2snc3ccccc23)CC1.
What is the InChIKey of N-(4-methylcyclohexyl)-2,1-benzothiazol-3-amine?
The InChIKey is AQGJCCSSWBDPCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2S/c1-10-6-8-11(9-7-10)15-14-12-4-2-3-5-13(12)16-17-14/h2-5,10-11,15H,6-9H2,1H3.
What are the key properties of N-(4-methylcyclohexyl)-2,1-benzothiazol-3-amine?
N-(4-methylcyclohexyl)-2,1-benzothiazol-3-amine has a molecular weight of 246.38 g/mol, XLogP of 4.29, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methylcyclohexyl)-2,1-benzothiazol-3-amine is sourced from PubChem (CID 62815339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).