C12H17N3O2S — CID 62816359
5-amino-1-[2-oxo-2-(1,4-thiazepan-4-yl)ethyl]pyridin-2-one (PubChem CID 62816359) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is 5-amino-1-[2-oxo-2-(1,4-thiazepan-4-yl)ethyl]pyridin-2-one.
| Compound Name | 5-amino-1-[2-oxo-2-(1,4-thiazepan-4-yl)ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 62816359 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 5-amino-1-[2-oxo-2-(1,4-thiazepan-4-yl)ethyl]pyridin-2-one |
| SMILES | Nc1ccc(=O)n(CC(=O)N2CCCSCC2)c1 |
| InChI | InChI=1S/C12H17N3O2S/c13-10-2-3-11(16)15(8-10)9-12(17)14-4-1-6-18-7-5-14/h2-3,8H,1,4-7,9,13H2 |
| InChIKey | IIUQYEBUTWQYRW-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |