About (2-oxoazepan-3-yl) 2-(5-amino-2-oxo-1-pyridinyl)acetate
(2-oxoazepan-3-yl) 2-(5-amino-2-oxo-1-pyridinyl)acetate (PubChem CID 62816374) has the molecular formula C13H17N3O4
and a molecular weight of 279.30 g/mol. Its IUPAC name is (2-oxoazepan-3-yl) 2-(5-amino-2-oxo-1-pyridinyl)acetate.
Molecular Properties
| Compound Name | (2-oxoazepan-3-yl) 2-(5-amino-2-oxo-1-pyridinyl)acetate |
| PubChem CID | 62816374 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | (2-oxoazepan-3-yl) 2-(5-amino-2-oxo-1-pyridinyl)acetate |
| SMILES | Nc1ccc(=O)n(CC(=O)OC2CCCCNC2=O)c1 |
| InChI | InChI=1S/C13H17N3O4/c14-9-4-5-11(17)16(7-9)8-12(18)20-10-3-1-2-6-15-13(10)19/h4-5,7,10H,1-3,6,8,14H2,(H,15,19) |
| InChIKey | YBSJAVBLFWRGDD-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-oxoazepan-3-yl) 2-(5-amino-2-oxo-1-pyridinyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxoazepan-3-yl) 2-(5-amino-2-oxo-1-pyridinyl)acetate?
The IUPAC name of (2-oxoazepan-3-yl) 2-(5-amino-2-oxo-1-pyridinyl)acetate (CID 62816374) is (2-oxoazepan-3-yl) 2-(5-amino-2-oxo-1-pyridinyl)acetate.
What is the SMILES notation for (2-oxoazepan-3-yl) 2-(5-amino-2-oxo-1-pyridinyl)acetate?
The canonical SMILES for (2-oxoazepan-3-yl) 2-(5-amino-2-oxo-1-pyridinyl)acetate is Nc1ccc(=O)n(CC(=O)OC2CCCCNC2=O)c1.
What is the InChIKey of (2-oxoazepan-3-yl) 2-(5-amino-2-oxo-1-pyridinyl)acetate?
The InChIKey is YBSJAVBLFWRGDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O4/c14-9-4-5-11(17)16(7-9)8-12(18)20-10-3-1-2-6-15-13(10)19/h4-5,7,10H,1-3,6,8,14H2,(H,15,19).
What are the key properties of (2-oxoazepan-3-yl) 2-(5-amino-2-oxo-1-pyridinyl)acetate?
(2-oxoazepan-3-yl) 2-(5-amino-2-oxo-1-pyridinyl)acetate has a molecular weight of 279.30 g/mol, XLogP of -0.36, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxoazepan-3-yl) 2-(5-amino-2-oxo-1-pyridinyl)acetate is sourced from PubChem (CID 62816374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).