About 1-cyanoethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate
1-cyanoethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate (PubChem CID 62816378) has the molecular formula C10H11N3O3
and a molecular weight of 221.22 g/mol. Its IUPAC name is 1-cyanoethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate.
Molecular Properties
| Compound Name | 1-cyanoethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate |
| PubChem CID | 62816378 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 1-cyanoethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate |
| SMILES | CC(C#N)OC(=O)Cn1cc(N)ccc1=O |
| InChI | InChI=1S/C10H11N3O3/c1-7(4-11)16-10(15)6-13-5-8(12)2-3-9(13)14/h2-3,5,7H,6,12H2,1H3 |
| InChIKey | ANVBHIGWYQRRJD-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 98.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-cyanoethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyanoethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate?
The IUPAC name of 1-cyanoethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate (CID 62816378) is 1-cyanoethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate.
What is the SMILES notation for 1-cyanoethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate?
The canonical SMILES for 1-cyanoethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate is CC(C#N)OC(=O)Cn1cc(N)ccc1=O.
What is the InChIKey of 1-cyanoethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate?
The InChIKey is ANVBHIGWYQRRJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O3/c1-7(4-11)16-10(15)6-13-5-8(12)2-3-9(13)14/h2-3,5,7H,6,12H2,1H3.
What are the key properties of 1-cyanoethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate?
1-cyanoethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate has a molecular weight of 221.22 g/mol, XLogP of -0.11, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyanoethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate is sourced from PubChem (CID 62816378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).