C9H15NO3 — CID 62817910
2-[cyclopropanecarbonyl(methyl)amino]-2-methylpropanoic acid (PubChem CID 62817910) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 2-[cyclopropanecarbonyl(methyl)amino]-2-methylpropanoic acid.
| Compound Name | 2-[cyclopropanecarbonyl(methyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 62817910 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 2-[cyclopropanecarbonyl(methyl)amino]-2-methylpropanoic acid |
| SMILES | CN(C(=O)C1CC1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C9H15NO3/c1-9(2,8(12)13)10(3)7(11)6-4-5-6/h6H,4-5H2,1-3H3,(H,12,13) |
| InChIKey | HJCJAQHZTCPICV-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |