C12H10F5NO3 — CID 62817966
2-methyl-2-[methyl-(2,3,4,5,6-pentafluorobenzoyl)amino]propanoic acid (PubChem CID 62817966) has the molecular formula C12H10F5NO3 and a molecular weight of 311.21 g/mol. Its IUPAC name is 2-methyl-2-[methyl-(2,3,4,5,6-pentafluorobenzoyl)amino]propanoic acid.
| Compound Name | 2-methyl-2-[methyl-(2,3,4,5,6-pentafluorobenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 62817966 |
| Molecular Formula | C12H10F5NO3 |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-methyl-2-[methyl-(2,3,4,5,6-pentafluorobenzoyl)amino]propanoic acid |
| SMILES | CN(C(=O)c1c(F)c(F)c(F)c(F)c1F)C(C)(C)C(=O)O |
| InChI | InChI=1S/C12H10F5NO3/c1-12(2,11(20)21)18(3)10(19)4-5(13)7(15)9(17)8(16)6(4)14/h1-3H3,(H,20,21) |
| InChIKey | ZANSYZCDMCVCFP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|