C15H20BrClO — CID 6281805
(6Z)-8-(1-bromopropyl)-3-chloro-2-[(E)-pent-2-en-4-ynyl]-3,4,5,8-tetrahydro-2H-oxocine (PubChem CID 6281805) has the molecular formula C15H20BrClO and a molecular weight of 331.68 g/mol. Its IUPAC name is (6Z)-8-(1-bromopropyl)-3-chloro-2-[(E)-pent-2-en-4-ynyl]-3,4,5,8-tetrahydro-2H-oxocine.
| Compound Name | (6Z)-8-(1-bromopropyl)-3-chloro-2-[(E)-pent-2-en-4-ynyl]-3,4,5,8-tetrahydro-2H-oxocine |
|---|---|
| PubChem CID | 6281805 |
| Molecular Formula | C15H20BrClO |
| Molecular Weight | 331.68 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | (6Z)-8-(1-bromopropyl)-3-chloro-2-[(E)-pent-2-en-4-ynyl]-3,4,5,8-tetrahydro-2H-oxocine |
| SMILES | C#C/C=C/CC1OC(C(Br)CC)/C=C\CCC1Cl |
| InChI | InChI=1S/C15H20BrClO/c1-3-5-6-11-15-13(17)9-7-8-10-14(18-15)12(16)4-2/h1,5-6,8,10,12-15H,4,7,9,11H2,2H3/b6-5+,10-8- |
| InChIKey | GTVGDHJJTJOZTO-VOFQGDAYSA-N |
| XLogP | 4.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.68 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|