C15H22N2O3 — CID 62820744
2-[ethyl-[ethyl(phenyl)carbamoyl]amino]-2-methylpropanoic acid (PubChem CID 62820744) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-[ethyl-[ethyl(phenyl)carbamoyl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[ethyl-[ethyl(phenyl)carbamoyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 62820744 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2-[ethyl-[ethyl(phenyl)carbamoyl]amino]-2-methylpropanoic acid |
| SMILES | CCN(C(=O)N(CC)C(C)(C)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C15H22N2O3/c1-5-16(12-10-8-7-9-11-12)14(20)17(6-2)15(3,4)13(18)19/h7-11H,5-6H2,1-4H3,(H,18,19) |
| InChIKey | IUGBRBYMRBZPPL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |