C12H25N3O3 — CID 62820771
2-[ethyl-[3-(ethylamino)propylcarbamoyl]amino]-2-methylpropanoic acid (PubChem CID 62820771) has the molecular formula C12H25N3O3 and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-[ethyl-[3-(ethylamino)propylcarbamoyl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[ethyl-[3-(ethylamino)propylcarbamoyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 62820771 |
| Molecular Formula | C12H25N3O3 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 2-[ethyl-[3-(ethylamino)propylcarbamoyl]amino]-2-methylpropanoic acid |
| SMILES | CCNCCCNC(=O)N(CC)C(C)(C)C(=O)O |
| InChI | InChI=1S/C12H25N3O3/c1-5-13-8-7-9-14-11(18)15(6-2)12(3,4)10(16)17/h13H,5-9H2,1-4H3,(H,14,18)(H,16,17) |
| InChIKey | VXYCVXHIRWSWLI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|