C13H18N2O3S — CID 62823134
N-(oxolan-3-ylmethyl)-2,3-dihydro-1H-indole-5-sulfonamide (PubChem CID 62823134) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is N-(oxolan-3-ylmethyl)-2,3-dihydro-1H-indole-5-sulfonamide.
| Compound Name | N-(oxolan-3-ylmethyl)-2,3-dihydro-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 62823134 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-(oxolan-3-ylmethyl)-2,3-dihydro-1H-indole-5-sulfonamide |
| SMILES | O=S(=O)(NCC1CCOC1)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C13H18N2O3S/c16-19(17,15-8-10-4-6-18-9-10)12-1-2-13-11(7-12)3-5-14-13/h1-2,7,10,14-15H,3-6,8-9H2 |
| InChIKey | COKQTIWGWXVINH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |