C16H24N4O — CID 62823945
2-(1,4-diazepan-1-ylmethyl)-1-(2-methoxyethyl)benzimidazole (PubChem CID 62823945) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-ylmethyl)-1-(2-methoxyethyl)benzimidazole.
| Compound Name | 2-(1,4-diazepan-1-ylmethyl)-1-(2-methoxyethyl)benzimidazole |
|---|---|
| PubChem CID | 62823945 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 2-(1,4-diazepan-1-ylmethyl)-1-(2-methoxyethyl)benzimidazole |
| SMILES | COCCn1c(CN2CCCNCC2)nc2ccccc21 |
| InChI | InChI=1S/C16H24N4O/c1-21-12-11-20-15-6-3-2-5-14(15)18-16(20)13-19-9-4-7-17-8-10-19/h2-3,5-6,17H,4,7-13H2,1H3 |
| InChIKey | FFQZWMFQHBMIOE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |