C11H16N2O — CID 62824000
4-N-(oxolan-3-ylmethyl)benzene-1,4-diamine (PubChem CID 62824000) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 4-N-(oxolan-3-ylmethyl)benzene-1,4-diamine.
| Compound Name | 4-N-(oxolan-3-ylmethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 62824000 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 4-N-(oxolan-3-ylmethyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(NCC2CCOC2)cc1 |
| InChI | InChI=1S/C11H16N2O/c12-10-1-3-11(4-2-10)13-7-9-5-6-14-8-9/h1-4,9,13H,5-8,12H2 |
| InChIKey | WKYRRIVPDNXZFO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|