2-[4-(3-bromobenzoyl)-1,4-diazepan-1-yl]acetic acid

C14H17BrN2O3 — CID 62824100

IUPAC2-[4-(3-bromobenzoyl)-1,4-diazepan-1-yl]acetic acid
SMILESO=C(O)CN1CCCN(C(=O)c2cccc(Br)c2)CC1
InChIInChI=1S/C14H17BrN2O3/c15-12-4-1-3-11(9-12)14(20)17-6-2-5-16(7-8-17)10-13(18)19/h1,3-4,9H,2,5-8,10H2,(H,18,19)
InChIKeyYUURCNAZZRYNNM-UHFFFAOYSA-N
MW341.20 g/mol
LogP1.68
Rot. Bonds3

About 2-[4-(3-bromobenzoyl)-1,4-diazepan-1-yl]acetic acid

2-[4-(3-bromobenzoyl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 62824100) has the molecular formula C14H17BrN2O3 and a molecular weight of 341.20 g/mol. Its IUPAC name is 2-[4-(3-bromobenzoyl)-1,4-diazepan-1-yl]acetic acid.

Molecular Properties

Compound Name2-[4-(3-bromobenzoyl)-1,4-diazepan-1-yl]acetic acid
PubChem CID62824100
Molecular FormulaC14H17BrN2O3
Molecular Weight341.20 g/mol
Exact Mass340.04
IUPAC Name2-[4-(3-bromobenzoyl)-1,4-diazepan-1-yl]acetic acid
SMILESO=C(O)CN1CCCN(C(=O)c2cccc(Br)c2)CC1
InChIInChI=1S/C14H17BrN2O3/c15-12-4-1-3-11(9-12)14(20)17-6-2-5-16(7-8-17)10-13(18)19/h1,3-4,9H,2,5-8,10H2,(H,18,19)
InChIKeyYUURCNAZZRYNNM-UHFFFAOYSA-N
XLogP1.68
TPSA60.85 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500341.20
LogP ≤ 51.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[4-(3-bromobenzoyl)-1,4-diazepan-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(3-bromobenzoyl)-1,4-diazepan-1-yl]acetic acid?
The IUPAC name of 2-[4-(3-bromobenzoyl)-1,4-diazepan-1-yl]acetic acid (CID 62824100) is 2-[4-(3-bromobenzoyl)-1,4-diazepan-1-yl]acetic acid.
What is the SMILES notation for 2-[4-(3-bromobenzoyl)-1,4-diazepan-1-yl]acetic acid?
The canonical SMILES for 2-[4-(3-bromobenzoyl)-1,4-diazepan-1-yl]acetic acid is O=C(O)CN1CCCN(C(=O)c2cccc(Br)c2)CC1.
What is the InChIKey of 2-[4-(3-bromobenzoyl)-1,4-diazepan-1-yl]acetic acid?
The InChIKey is YUURCNAZZRYNNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BrN2O3/c15-12-4-1-3-11(9-12)14(20)17-6-2-5-16(7-8-17)10-13(18)19/h1,3-4,9H,2,5-8,10H2,(H,18,19).
What are the key properties of 2-[4-(3-bromobenzoyl)-1,4-diazepan-1-yl]acetic acid?
2-[4-(3-bromobenzoyl)-1,4-diazepan-1-yl]acetic acid has a molecular weight of 341.20 g/mol, XLogP of 1.68, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3-bromobenzoyl)-1,4-diazepan-1-yl]acetic acid is sourced from PubChem (CID 62824100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).