About 2-[4-(3-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]acetic acid
2-[4-(3-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]acetic acid (PubChem CID 62824660) has the molecular formula C11H15BrN2O4S2
and a molecular weight of 383.29 g/mol. Its IUPAC name is 2-[4-(3-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-(3-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]acetic acid |
| PubChem CID | 62824660 |
| Molecular Formula | C11H15BrN2O4S2 |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | 2-[4-(3-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCCN(S(=O)(=O)c2sccc2Br)CC1 |
| InChI | InChI=1S/C11H15BrN2O4S2/c12-9-2-7-19-11(9)20(17,18)14-4-1-3-13(5-6-14)8-10(15)16/h2,7H,1,3-6,8H2,(H,15,16) |
| InChIKey | YSRLCZLAKGVAGE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(3-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]acetic acid?
The IUPAC name of 2-[4-(3-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]acetic acid (CID 62824660) is 2-[4-(3-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]acetic acid.
What is the SMILES notation for 2-[4-(3-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]acetic acid?
The canonical SMILES for 2-[4-(3-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]acetic acid is O=C(O)CN1CCCN(S(=O)(=O)c2sccc2Br)CC1.
What is the InChIKey of 2-[4-(3-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]acetic acid?
The InChIKey is YSRLCZLAKGVAGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrN2O4S2/c12-9-2-7-19-11(9)20(17,18)14-4-1-3-13(5-6-14)8-10(15)16/h2,7H,1,3-6,8H2,(H,15,16).
What are the key properties of 2-[4-(3-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]acetic acid?
2-[4-(3-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]acetic acid has a molecular weight of 383.29 g/mol, XLogP of 1.29, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]acetic acid is sourced from PubChem (CID 62824660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).