About 2-[4-(1,3-benzothiazol-2-yl)-1,4-diazepan-1-yl]acetic acid
2-[4-(1,3-benzothiazol-2-yl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 62824679) has the molecular formula C14H17N3O2S
and a molecular weight of 291.38 g/mol. Its IUPAC name is 2-[4-(1,3-benzothiazol-2-yl)-1,4-diazepan-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-(1,3-benzothiazol-2-yl)-1,4-diazepan-1-yl]acetic acid |
| PubChem CID | 62824679 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-[4-(1,3-benzothiazol-2-yl)-1,4-diazepan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCCN(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C14H17N3O2S/c18-13(19)10-16-6-3-7-17(9-8-16)14-15-11-4-1-2-5-12(11)20-14/h1-2,4-5H,3,6-10H2,(H,18,19) |
| InChIKey | OXXSXCNXSGPJNA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(1,3-benzothiazol-2-yl)-1,4-diazepan-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1,3-benzothiazol-2-yl)-1,4-diazepan-1-yl]acetic acid?
The IUPAC name of 2-[4-(1,3-benzothiazol-2-yl)-1,4-diazepan-1-yl]acetic acid (CID 62824679) is 2-[4-(1,3-benzothiazol-2-yl)-1,4-diazepan-1-yl]acetic acid.
What is the SMILES notation for 2-[4-(1,3-benzothiazol-2-yl)-1,4-diazepan-1-yl]acetic acid?
The canonical SMILES for 2-[4-(1,3-benzothiazol-2-yl)-1,4-diazepan-1-yl]acetic acid is O=C(O)CN1CCCN(c2nc3ccccc3s2)CC1.
What is the InChIKey of 2-[4-(1,3-benzothiazol-2-yl)-1,4-diazepan-1-yl]acetic acid?
The InChIKey is OXXSXCNXSGPJNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O2S/c18-13(19)10-16-6-3-7-17(9-8-16)14-15-11-4-1-2-5-12(11)20-14/h1-2,4-5H,3,6-10H2,(H,18,19).
What are the key properties of 2-[4-(1,3-benzothiazol-2-yl)-1,4-diazepan-1-yl]acetic acid?
2-[4-(1,3-benzothiazol-2-yl)-1,4-diazepan-1-yl]acetic acid has a molecular weight of 291.38 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,3-benzothiazol-2-yl)-1,4-diazepan-1-yl]acetic acid is sourced from PubChem (CID 62824679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).