About 4,6-dimethyl-1-(oxolan-3-ylmethyl)-1,5-diazocane
4,6-dimethyl-1-(oxolan-3-ylmethyl)-1,5-diazocane (PubChem CID 62824730) has the molecular formula C13H26N2O
and a molecular weight of 226.36 g/mol. Its IUPAC name is 4,6-dimethyl-1-(oxolan-3-ylmethyl)-1,5-diazocane.
Molecular Properties
| Compound Name | 4,6-dimethyl-1-(oxolan-3-ylmethyl)-1,5-diazocane |
| PubChem CID | 62824730 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 4,6-dimethyl-1-(oxolan-3-ylmethyl)-1,5-diazocane |
| SMILES | CC1CCN(CC2CCOC2)CCC(C)N1 |
| InChI | InChI=1S/C13H26N2O/c1-11-3-6-15(7-4-12(2)14-11)9-13-5-8-16-10-13/h11-14H,3-10H2,1-2H3 |
| InChIKey | SPDQOXPDCDYGRN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,6-dimethyl-1-(oxolan-3-ylmethyl)-1,5-diazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-1-(oxolan-3-ylmethyl)-1,5-diazocane?
The IUPAC name of 4,6-dimethyl-1-(oxolan-3-ylmethyl)-1,5-diazocane (CID 62824730) is 4,6-dimethyl-1-(oxolan-3-ylmethyl)-1,5-diazocane.
What is the SMILES notation for 4,6-dimethyl-1-(oxolan-3-ylmethyl)-1,5-diazocane?
The canonical SMILES for 4,6-dimethyl-1-(oxolan-3-ylmethyl)-1,5-diazocane is CC1CCN(CC2CCOC2)CCC(C)N1.
What is the InChIKey of 4,6-dimethyl-1-(oxolan-3-ylmethyl)-1,5-diazocane?
The InChIKey is SPDQOXPDCDYGRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O/c1-11-3-6-15(7-4-12(2)14-11)9-13-5-8-16-10-13/h11-14H,3-10H2,1-2H3.
What are the key properties of 4,6-dimethyl-1-(oxolan-3-ylmethyl)-1,5-diazocane?
4,6-dimethyl-1-(oxolan-3-ylmethyl)-1,5-diazocane has a molecular weight of 226.36 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-1-(oxolan-3-ylmethyl)-1,5-diazocane is sourced from PubChem (CID 62824730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).