C12H21N3O3 — CID 62825334
2-[4-(pyrrolidine-2-carbonyl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 62825334) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-[4-(pyrrolidine-2-carbonyl)-1,4-diazepan-1-yl]acetic acid.
| Compound Name | 2-[4-(pyrrolidine-2-carbonyl)-1,4-diazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 62825334 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-[4-(pyrrolidine-2-carbonyl)-1,4-diazepan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCCN(C(=O)C2CCCN2)CC1 |
| InChI | InChI=1S/C12H21N3O3/c16-11(17)9-14-5-2-6-15(8-7-14)12(18)10-3-1-4-13-10/h10,13H,1-9H2,(H,16,17) |
| InChIKey | FNTAFROAAMDQPY-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |