About (3-methylcyclohexyl) 2-(1,4-diazepan-1-yl)acetate
(3-methylcyclohexyl) 2-(1,4-diazepan-1-yl)acetate (PubChem CID 62825536) has the molecular formula C14H26N2O2
and a molecular weight of 254.37 g/mol. Its IUPAC name is (3-methylcyclohexyl) 2-(1,4-diazepan-1-yl)acetate.
Molecular Properties
| Compound Name | (3-methylcyclohexyl) 2-(1,4-diazepan-1-yl)acetate |
| PubChem CID | 62825536 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | (3-methylcyclohexyl) 2-(1,4-diazepan-1-yl)acetate |
| SMILES | CC1CCCC(OC(=O)CN2CCCNCC2)C1 |
| InChI | InChI=1S/C14H26N2O2/c1-12-4-2-5-13(10-12)18-14(17)11-16-8-3-6-15-7-9-16/h12-13,15H,2-11H2,1H3 |
| InChIKey | LETULMJVENOMKD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methylcyclohexyl) 2-(1,4-diazepan-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylcyclohexyl) 2-(1,4-diazepan-1-yl)acetate?
The IUPAC name of (3-methylcyclohexyl) 2-(1,4-diazepan-1-yl)acetate (CID 62825536) is (3-methylcyclohexyl) 2-(1,4-diazepan-1-yl)acetate.
What is the SMILES notation for (3-methylcyclohexyl) 2-(1,4-diazepan-1-yl)acetate?
The canonical SMILES for (3-methylcyclohexyl) 2-(1,4-diazepan-1-yl)acetate is CC1CCCC(OC(=O)CN2CCCNCC2)C1.
What is the InChIKey of (3-methylcyclohexyl) 2-(1,4-diazepan-1-yl)acetate?
The InChIKey is LETULMJVENOMKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O2/c1-12-4-2-5-13(10-12)18-14(17)11-16-8-3-6-15-7-9-16/h12-13,15H,2-11H2,1H3.
What are the key properties of (3-methylcyclohexyl) 2-(1,4-diazepan-1-yl)acetate?
(3-methylcyclohexyl) 2-(1,4-diazepan-1-yl)acetate has a molecular weight of 254.37 g/mol, XLogP of 1.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylcyclohexyl) 2-(1,4-diazepan-1-yl)acetate is sourced from PubChem (CID 62825536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).