3-[ethyl(1,2-oxazole-3-carbonyl)amino]butanoic acid

C10H14N2O4 — CID 62826001

IUPAC3-[ethyl(1,2-oxazole-3-carbonyl)amino]butanoic acid
SMILESCCN(C(=O)c1ccon1)C(C)CC(=O)O
InChIInChI=1S/C10H14N2O4/c1-3-12(7(2)6-9(13)14)10(15)8-4-5-16-11-8/h4-5,7H,3,6H2,1-2H3,(H,13,14)
InChIKeyWAOYKFNUPOIEGX-UHFFFAOYSA-N
MW226.23 g/mol
LogP1.00
Rot. Bonds5

About 3-[ethyl(1,2-oxazole-3-carbonyl)amino]butanoic acid

3-[ethyl(1,2-oxazole-3-carbonyl)amino]butanoic acid (PubChem CID 62826001) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 3-[ethyl(1,2-oxazole-3-carbonyl)amino]butanoic acid.

Molecular Properties

Compound Name3-[ethyl(1,2-oxazole-3-carbonyl)amino]butanoic acid
PubChem CID62826001
Molecular FormulaC10H14N2O4
Molecular Weight226.23 g/mol
Exact Mass226.10
IUPAC Name3-[ethyl(1,2-oxazole-3-carbonyl)amino]butanoic acid
SMILESCCN(C(=O)c1ccon1)C(C)CC(=O)O
InChIInChI=1S/C10H14N2O4/c1-3-12(7(2)6-9(13)14)10(15)8-4-5-16-11-8/h4-5,7H,3,6H2,1-2H3,(H,13,14)
InChIKeyWAOYKFNUPOIEGX-UHFFFAOYSA-N
XLogP1.00
TPSA83.64 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.23
LogP ≤ 51.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[ethyl(1,2-oxazole-3-carbonyl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[ethyl(1,2-oxazole-3-carbonyl)amino]butanoic acid?
The IUPAC name of 3-[ethyl(1,2-oxazole-3-carbonyl)amino]butanoic acid (CID 62826001) is 3-[ethyl(1,2-oxazole-3-carbonyl)amino]butanoic acid.
What is the SMILES notation for 3-[ethyl(1,2-oxazole-3-carbonyl)amino]butanoic acid?
The canonical SMILES for 3-[ethyl(1,2-oxazole-3-carbonyl)amino]butanoic acid is CCN(C(=O)c1ccon1)C(C)CC(=O)O.
What is the InChIKey of 3-[ethyl(1,2-oxazole-3-carbonyl)amino]butanoic acid?
The InChIKey is WAOYKFNUPOIEGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O4/c1-3-12(7(2)6-9(13)14)10(15)8-4-5-16-11-8/h4-5,7H,3,6H2,1-2H3,(H,13,14).
What are the key properties of 3-[ethyl(1,2-oxazole-3-carbonyl)amino]butanoic acid?
3-[ethyl(1,2-oxazole-3-carbonyl)amino]butanoic acid has a molecular weight of 226.23 g/mol, XLogP of 1.00, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[ethyl(1,2-oxazole-3-carbonyl)amino]butanoic acid is sourced from PubChem (CID 62826001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).