3-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]butanoic acid

C14H19NO4 — CID 62827804

IUPAC3-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]butanoic acid
SMILESCCN(Cc1ccc2c(c1)OCO2)C(C)CC(=O)O
InChIInChI=1S/C14H19NO4/c1-3-15(10(2)6-14(16)17)8-11-4-5-12-13(7-11)19-9-18-12/h4-5,7,10H,3,6,8-9H2,1-2H3,(H,16,17)
InChIKeyJTEBJDGRDWZXJX-UHFFFAOYSA-N
MW265.31 g/mol
LogP2.10
Rot. Bonds6

About 3-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]butanoic acid

3-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]butanoic acid (PubChem CID 62827804) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]butanoic acid.

Molecular Properties

Compound Name3-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]butanoic acid
PubChem CID62827804
Molecular FormulaC14H19NO4
Molecular Weight265.31 g/mol
Exact Mass265.13
IUPAC Name3-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]butanoic acid
SMILESCCN(Cc1ccc2c(c1)OCO2)C(C)CC(=O)O
InChIInChI=1S/C14H19NO4/c1-3-15(10(2)6-14(16)17)8-11-4-5-12-13(7-11)19-9-18-12/h4-5,7,10H,3,6,8-9H2,1-2H3,(H,16,17)
InChIKeyJTEBJDGRDWZXJX-UHFFFAOYSA-N
XLogP2.10
TPSA59.00 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.31
LogP ≤ 52.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]butanoic acid?
The IUPAC name of 3-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]butanoic acid (CID 62827804) is 3-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]butanoic acid.
What is the SMILES notation for 3-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]butanoic acid?
The canonical SMILES for 3-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]butanoic acid is CCN(Cc1ccc2c(c1)OCO2)C(C)CC(=O)O.
What is the InChIKey of 3-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]butanoic acid?
The InChIKey is JTEBJDGRDWZXJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO4/c1-3-15(10(2)6-14(16)17)8-11-4-5-12-13(7-11)19-9-18-12/h4-5,7,10H,3,6,8-9H2,1-2H3,(H,16,17).
What are the key properties of 3-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]butanoic acid?
3-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]butanoic acid has a molecular weight of 265.31 g/mol, XLogP of 2.10, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]butanoic acid is sourced from PubChem (CID 62827804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).