C19H18F3NO3S — CID 6282838
(Z)-2-benzylsulfonyl-3-(dimethylamino)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 6282838) has the molecular formula C19H18F3NO3S and a molecular weight of 397.42 g/mol. Its IUPAC name is (Z)-2-benzylsulfonyl-3-(dimethylamino)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (Z)-2-benzylsulfonyl-3-(dimethylamino)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 6282838 |
| Molecular Formula | C19H18F3NO3S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | (Z)-2-benzylsulfonyl-3-(dimethylamino)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | CN(C)/C=C(/C(=O)c1cccc(C(F)(F)F)c1)S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C19H18F3NO3S/c1-23(2)12-17(27(25,26)13-14-7-4-3-5-8-14)18(24)15-9-6-10-16(11-15)19(20,21)22/h3-12H,13H2,1-2H3/b17-12- |
| InChIKey | WEOGQVJYUSLLLY-ATVHPVEESA-N |
| XLogP | 3.91 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|