About 5-bromo-4-[methyl(2,2,2-trifluoroethyl)sulfamoyl]furan-2-carboxylic acid
5-bromo-4-[methyl(2,2,2-trifluoroethyl)sulfamoyl]furan-2-carboxylic acid (PubChem CID 62829351) has the molecular formula C8H7BrF3NO5S
and a molecular weight of 366.11 g/mol. Its IUPAC name is 5-bromo-4-[methyl(2,2,2-trifluoroethyl)sulfamoyl]furan-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-bromo-4-[methyl(2,2,2-trifluoroethyl)sulfamoyl]furan-2-carboxylic acid |
| PubChem CID | 62829351 |
| Molecular Formula | C8H7BrF3NO5S |
| Molecular Weight | 366.11 g/mol |
| Exact Mass | 364.92 |
| IUPAC Name | 5-bromo-4-[methyl(2,2,2-trifluoroethyl)sulfamoyl]furan-2-carboxylic acid |
| SMILES | CN(CC(F)(F)F)S(=O)(=O)c1cc(C(=O)O)oc1Br |
| InChI | InChI=1S/C8H7BrF3NO5S/c1-13(3-8(10,11)12)19(16,17)5-2-4(7(14)15)18-6(5)9/h2H,3H2,1H3,(H,14,15) |
| InChIKey | WQCAFDKPCBXBAO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.11 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-4-[methyl(2,2,2-trifluoroethyl)sulfamoyl]furan-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-[methyl(2,2,2-trifluoroethyl)sulfamoyl]furan-2-carboxylic acid?
The IUPAC name of 5-bromo-4-[methyl(2,2,2-trifluoroethyl)sulfamoyl]furan-2-carboxylic acid (CID 62829351) is 5-bromo-4-[methyl(2,2,2-trifluoroethyl)sulfamoyl]furan-2-carboxylic acid.
What is the SMILES notation for 5-bromo-4-[methyl(2,2,2-trifluoroethyl)sulfamoyl]furan-2-carboxylic acid?
The canonical SMILES for 5-bromo-4-[methyl(2,2,2-trifluoroethyl)sulfamoyl]furan-2-carboxylic acid is CN(CC(F)(F)F)S(=O)(=O)c1cc(C(=O)O)oc1Br.
What is the InChIKey of 5-bromo-4-[methyl(2,2,2-trifluoroethyl)sulfamoyl]furan-2-carboxylic acid?
The InChIKey is WQCAFDKPCBXBAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrF3NO5S/c1-13(3-8(10,11)12)19(16,17)5-2-4(7(14)15)18-6(5)9/h2H,3H2,1H3,(H,14,15).
What are the key properties of 5-bromo-4-[methyl(2,2,2-trifluoroethyl)sulfamoyl]furan-2-carboxylic acid?
5-bromo-4-[methyl(2,2,2-trifluoroethyl)sulfamoyl]furan-2-carboxylic acid has a molecular weight of 366.11 g/mol, XLogP of 1.92, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-[methyl(2,2,2-trifluoroethyl)sulfamoyl]furan-2-carboxylic acid is sourced from PubChem (CID 62829351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).