C20H16ClFN4OS — CID 6283054
(6Z)-6-[[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-3-methyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one (PubChem CID 6283054) has the molecular formula C20H16ClFN4OS and a molecular weight of 414.89 g/mol. Its IUPAC name is (6Z)-6-[[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-3-methyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-3-methyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 6283054 |
| Molecular Formula | C20H16ClFN4OS |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | (6Z)-6-[[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-3-methyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2cc(C)n(-c3ccc(F)c(Cl)c3)c2C)/C(=O)N=C2SC=C(C)N2/1 |
| InChI | InChI=1S/C20H16ClFN4OS/c1-10-6-13(12(3)25(10)14-4-5-17(22)16(21)8-14)7-15-18(23)26-11(2)9-28-20(26)24-19(15)27/h4-9,23H,1-3H3/b15-7-,23-18- |
| InChIKey | CRVSWHJGFMPKEN-XNLXCSNWSA-N |
| XLogP | 5.05 |
| TPSA | 61.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|