C17H16N2O2 — CID 62830959
N-[3-(3-hydroxyprop-1-ynyl)phenyl]-2,6-dimethylpyridine-3-carboxamide (PubChem CID 62830959) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is N-[3-(3-hydroxyprop-1-ynyl)phenyl]-2,6-dimethylpyridine-3-carboxamide.
| Compound Name | N-[3-(3-hydroxyprop-1-ynyl)phenyl]-2,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 62830959 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-[3-(3-hydroxyprop-1-ynyl)phenyl]-2,6-dimethylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(C#CCO)c2)c(C)n1 |
| InChI | InChI=1S/C17H16N2O2/c1-12-8-9-16(13(2)18-12)17(21)19-15-7-3-5-14(11-15)6-4-10-20/h3,5,7-9,11,20H,10H2,1-2H3,(H,19,21) |
| InChIKey | GHBJJCXAWSWQBO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|