About 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-N,N-diethylpropanamide
3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-N,N-diethylpropanamide (PubChem CID 62831331) has the molecular formula C14H22N4O
and a molecular weight of 262.36 g/mol. Its IUPAC name is 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-N,N-diethylpropanamide.
Molecular Properties
| Compound Name | 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-N,N-diethylpropanamide |
| PubChem CID | 62831331 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCNc1ncnc2c1CCC2 |
| InChI | InChI=1S/C14H22N4O/c1-3-18(4-2)13(19)8-9-15-14-11-6-5-7-12(11)16-10-17-14/h10H,3-9H2,1-2H3,(H,15,16,17) |
| InChIKey | MUURTEOJDCVGAY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-N,N-diethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-N,N-diethylpropanamide?
The IUPAC name of 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-N,N-diethylpropanamide (CID 62831331) is 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-N,N-diethylpropanamide.
What is the SMILES notation for 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-N,N-diethylpropanamide?
The canonical SMILES for 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-N,N-diethylpropanamide is CCN(CC)C(=O)CCNc1ncnc2c1CCC2.
What is the InChIKey of 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-N,N-diethylpropanamide?
The InChIKey is MUURTEOJDCVGAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O/c1-3-18(4-2)13(19)8-9-15-14-11-6-5-7-12(11)16-10-17-14/h10H,3-9H2,1-2H3,(H,15,16,17).
What are the key properties of 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-N,N-diethylpropanamide?
3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-N,N-diethylpropanamide has a molecular weight of 262.36 g/mol, XLogP of 1.64, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-N,N-diethylpropanamide is sourced from PubChem (CID 62831331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).