About ethyl 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate
ethyl 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate (PubChem CID 62831496) has the molecular formula C12H17N3O2
and a molecular weight of 235.29 g/mol. Its IUPAC name is ethyl 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate.
Molecular Properties
| Compound Name | ethyl 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate |
| PubChem CID | 62831496 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | ethyl 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate |
| SMILES | CCOC(=O)CCNc1ncnc2c1CCC2 |
| InChI | InChI=1S/C12H17N3O2/c1-2-17-11(16)6-7-13-12-9-4-3-5-10(9)14-8-15-12/h8H,2-7H2,1H3,(H,13,14,15) |
| InChIKey | NTVAAABVAOLTFA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate?
The IUPAC name of ethyl 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate (CID 62831496) is ethyl 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate.
What is the SMILES notation for ethyl 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate?
The canonical SMILES for ethyl 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate is CCOC(=O)CCNc1ncnc2c1CCC2.
What is the InChIKey of ethyl 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate?
The InChIKey is NTVAAABVAOLTFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O2/c1-2-17-11(16)6-7-13-12-9-4-3-5-10(9)14-8-15-12/h8H,2-7H2,1H3,(H,13,14,15).
What are the key properties of ethyl 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate?
ethyl 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate has a molecular weight of 235.29 g/mol, XLogP of 1.33, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate is sourced from PubChem (CID 62831496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).