About methyl 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate
methyl 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate (PubChem CID 62831506) has the molecular formula C11H15N3O2
and a molecular weight of 221.26 g/mol. Its IUPAC name is methyl 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate.
Molecular Properties
| Compound Name | methyl 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate |
| PubChem CID | 62831506 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | methyl 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate |
| SMILES | COC(=O)C(C)Nc1ncnc2c1CCC2 |
| InChI | InChI=1S/C11H15N3O2/c1-7(11(15)16-2)14-10-8-4-3-5-9(8)12-6-13-10/h6-7H,3-5H2,1-2H3,(H,12,13,14) |
| InChIKey | NSHWJTLJVZHFAY-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate?
The IUPAC name of methyl 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate (CID 62831506) is methyl 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate.
What is the SMILES notation for methyl 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate?
The canonical SMILES for methyl 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate is COC(=O)C(C)Nc1ncnc2c1CCC2.
What is the InChIKey of methyl 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate?
The InChIKey is NSHWJTLJVZHFAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O2/c1-7(11(15)16-2)14-10-8-4-3-5-9(8)12-6-13-10/h6-7H,3-5H2,1-2H3,(H,12,13,14).
What are the key properties of methyl 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate?
methyl 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate has a molecular weight of 221.26 g/mol, XLogP of 0.94, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)propanoate is sourced from PubChem (CID 62831506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).