About 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yloxy)phenol
3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yloxy)phenol (PubChem CID 62831524) has the molecular formula C13H12N2O2
and a molecular weight of 228.25 g/mol. Its IUPAC name is 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yloxy)phenol.
Molecular Properties
| Compound Name | 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yloxy)phenol |
| PubChem CID | 62831524 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yloxy)phenol |
| SMILES | Oc1cccc(Oc2ncnc3c2CCC3)c1 |
| InChI | InChI=1S/C13H12N2O2/c16-9-3-1-4-10(7-9)17-13-11-5-2-6-12(11)14-8-15-13/h1,3-4,7-8,16H,2,5-6H2 |
| InChIKey | YYHXWFURUWGEBV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yloxy)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yloxy)phenol?
The IUPAC name of 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yloxy)phenol (CID 62831524) is 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yloxy)phenol.
What is the SMILES notation for 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yloxy)phenol?
The canonical SMILES for 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yloxy)phenol is Oc1cccc(Oc2ncnc3c2CCC3)c1.
What is the InChIKey of 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yloxy)phenol?
The InChIKey is YYHXWFURUWGEBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O2/c16-9-3-1-4-10(7-9)17-13-11-5-2-6-12(11)14-8-15-13/h1,3-4,7-8,16H,2,5-6H2.
What are the key properties of 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yloxy)phenol?
3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yloxy)phenol has a molecular weight of 228.25 g/mol, XLogP of 2.46, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yloxy)phenol is sourced from PubChem (CID 62831524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).