About N-prop-2-enyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine
N-prop-2-enyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 62831874) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is N-prop-2-enyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-prop-2-enyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
| PubChem CID | 62831874 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | N-prop-2-enyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | C=CCNc1ncnc2c1CCC2 |
| InChI | InChI=1S/C10H13N3/c1-2-6-11-10-8-4-3-5-9(8)12-7-13-10/h2,7H,1,3-6H2,(H,11,12,13) |
| InChIKey | WIVDDYCNLVEGFN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-prop-2-enyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-2-enyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
The IUPAC name of N-prop-2-enyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine (CID 62831874) is N-prop-2-enyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine.
What is the SMILES notation for N-prop-2-enyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
The canonical SMILES for N-prop-2-enyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine is C=CCNc1ncnc2c1CCC2.
What is the InChIKey of N-prop-2-enyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
The InChIKey is WIVDDYCNLVEGFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-2-6-11-10-8-4-3-5-9(8)12-7-13-10/h2,7H,1,3-6H2,(H,11,12,13).
What are the key properties of N-prop-2-enyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
N-prop-2-enyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine has a molecular weight of 175.23 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-2-enyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine is sourced from PubChem (CID 62831874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).