About 2-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(propyl)amino]ethanol
2-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(propyl)amino]ethanol (PubChem CID 62832633) has the molecular formula C12H19N3O
and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(propyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(propyl)amino]ethanol |
| PubChem CID | 62832633 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 2-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(propyl)amino]ethanol |
| SMILES | CCCN(CCO)c1ncnc2c1CCC2 |
| InChI | InChI=1S/C12H19N3O/c1-2-6-15(7-8-16)12-10-4-3-5-11(10)13-9-14-12/h9,16H,2-8H2,1H3 |
| InChIKey | QACSCPMFXKEADF-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(propyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(propyl)amino]ethanol?
The IUPAC name of 2-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(propyl)amino]ethanol (CID 62832633) is 2-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(propyl)amino]ethanol.
What is the SMILES notation for 2-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(propyl)amino]ethanol?
The canonical SMILES for 2-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(propyl)amino]ethanol is CCCN(CCO)c1ncnc2c1CCC2.
What is the InChIKey of 2-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(propyl)amino]ethanol?
The InChIKey is QACSCPMFXKEADF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O/c1-2-6-15(7-8-16)12-10-4-3-5-11(10)13-9-14-12/h9,16H,2-8H2,1H3.
What are the key properties of 2-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(propyl)amino]ethanol?
2-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(propyl)amino]ethanol has a molecular weight of 221.30 g/mol, XLogP of 1.17, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(propyl)amino]ethanol is sourced from PubChem (CID 62832633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).