About N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N'-(2-methylpropyl)ethane-1,2-diamine
N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N'-(2-methylpropyl)ethane-1,2-diamine (PubChem CID 62832825) has the molecular formula C13H22N4
and a molecular weight of 234.35 g/mol. Its IUPAC name is N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N'-(2-methylpropyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N'-(2-methylpropyl)ethane-1,2-diamine |
| PubChem CID | 62832825 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N'-(2-methylpropyl)ethane-1,2-diamine |
| SMILES | CC(C)CN(CCN)c1ncnc2c1CCC2 |
| InChI | InChI=1S/C13H22N4/c1-10(2)8-17(7-6-14)13-11-4-3-5-12(11)15-9-16-13/h9-10H,3-8,14H2,1-2H3 |
| InChIKey | UDNYOFJNWTWXQW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N'-(2-methylpropyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N'-(2-methylpropyl)ethane-1,2-diamine?
The IUPAC name of N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N'-(2-methylpropyl)ethane-1,2-diamine (CID 62832825) is N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N'-(2-methylpropyl)ethane-1,2-diamine.
What is the SMILES notation for N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N'-(2-methylpropyl)ethane-1,2-diamine?
The canonical SMILES for N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N'-(2-methylpropyl)ethane-1,2-diamine is CC(C)CN(CCN)c1ncnc2c1CCC2.
What is the InChIKey of N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N'-(2-methylpropyl)ethane-1,2-diamine?
The InChIKey is UDNYOFJNWTWXQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4/c1-10(2)8-17(7-6-14)13-11-4-3-5-12(11)15-9-16-13/h9-10H,3-8,14H2,1-2H3.
What are the key properties of N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N'-(2-methylpropyl)ethane-1,2-diamine?
N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N'-(2-methylpropyl)ethane-1,2-diamine has a molecular weight of 234.35 g/mol, XLogP of 1.39, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N'-(2-methylpropyl)ethane-1,2-diamine is sourced from PubChem (CID 62832825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).