About [1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)cyclopentyl]methanol
[1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)cyclopentyl]methanol (PubChem CID 62833166) has the molecular formula C13H19N3O
and a molecular weight of 233.31 g/mol. Its IUPAC name is [1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)cyclopentyl]methanol.
Molecular Properties
| Compound Name | [1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)cyclopentyl]methanol |
| PubChem CID | 62833166 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | [1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)cyclopentyl]methanol |
| SMILES | OCC1(Nc2ncnc3c2CCC3)CCCC1 |
| InChI | InChI=1S/C13H19N3O/c17-8-13(6-1-2-7-13)16-12-10-4-3-5-11(10)14-9-15-12/h9,17H,1-8H2,(H,14,15,16) |
| InChIKey | MIJGQNJCDFYKQD-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)cyclopentyl]methanol?
The IUPAC name of [1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)cyclopentyl]methanol (CID 62833166) is [1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)cyclopentyl]methanol.
What is the SMILES notation for [1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)cyclopentyl]methanol?
The canonical SMILES for [1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)cyclopentyl]methanol is OCC1(Nc2ncnc3c2CCC3)CCCC1.
What is the InChIKey of [1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)cyclopentyl]methanol?
The InChIKey is MIJGQNJCDFYKQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O/c17-8-13(6-1-2-7-13)16-12-10-4-3-5-11(10)14-9-15-12/h9,17H,1-8H2,(H,14,15,16).
What are the key properties of [1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)cyclopentyl]methanol?
[1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)cyclopentyl]methanol has a molecular weight of 233.31 g/mol, XLogP of 1.68, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)cyclopentyl]methanol is sourced from PubChem (CID 62833166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).