C14H27N3O3 — CID 62836448
N-[1-[2-(ethylamino)-2-methylpropanoyl]piperidin-4-yl]-2-methoxyacetamide (PubChem CID 62836448) has the molecular formula C14H27N3O3 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-[1-[2-(ethylamino)-2-methylpropanoyl]piperidin-4-yl]-2-methoxyacetamide.
| Compound Name | N-[1-[2-(ethylamino)-2-methylpropanoyl]piperidin-4-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 62836448 |
| Molecular Formula | C14H27N3O3 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | N-[1-[2-(ethylamino)-2-methylpropanoyl]piperidin-4-yl]-2-methoxyacetamide |
| SMILES | CCNC(C)(C)C(=O)N1CCC(NC(=O)COC)CC1 |
| InChI | InChI=1S/C14H27N3O3/c1-5-15-14(2,3)13(19)17-8-6-11(7-9-17)16-12(18)10-20-4/h11,15H,5-10H2,1-4H3,(H,16,18) |
| InChIKey | PPRDUGZJUHIUAK-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |