About (2E,6E)-4-tert-butyl-2,6-bis[(3-fluorophenyl)methylidene]cyclohexan-1-one
(2E,6E)-4-tert-butyl-2,6-bis[(3-fluorophenyl)methylidene]cyclohexan-1-one (PubChem CID 6283777) has the molecular formula C24H24F2O
and a molecular weight of 366.45 g/mol. Its IUPAC name is (2E,6E)-4-tert-butyl-2,6-bis[(3-fluorophenyl)methylidene]cyclohexan-1-one.
Molecular Properties
| Compound Name | (2E,6E)-4-tert-butyl-2,6-bis[(3-fluorophenyl)methylidene]cyclohexan-1-one |
| PubChem CID | 6283777 |
| Molecular Formula | C24H24F2O |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (2E,6E)-4-tert-butyl-2,6-bis[(3-fluorophenyl)methylidene]cyclohexan-1-one |
| SMILES | CC(C)(C)C1C/C(=C\c2cccc(F)c2)C(=O)/C(=C/c2cccc(F)c2)C1 |
| InChI | InChI=1S/C24H24F2O/c1-24(2,3)20-14-18(10-16-6-4-8-21(25)12-16)23(27)19(15-20)11-17-7-5-9-22(26)13-17/h4-13,20H,14-15H2,1-3H3/b18-10+,19-11+ |
| InChIKey | LSYCOGKXLCOZAB-XOBNHNQQSA-N |
| XLogP | 6.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E,6E)-4-tert-butyl-2,6-bis[(3-fluorophenyl)methylidene]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,6E)-4-tert-butyl-2,6-bis[(3-fluorophenyl)methylidene]cyclohexan-1-one?
The IUPAC name of (2E,6E)-4-tert-butyl-2,6-bis[(3-fluorophenyl)methylidene]cyclohexan-1-one (CID 6283777) is (2E,6E)-4-tert-butyl-2,6-bis[(3-fluorophenyl)methylidene]cyclohexan-1-one.
What is the SMILES notation for (2E,6E)-4-tert-butyl-2,6-bis[(3-fluorophenyl)methylidene]cyclohexan-1-one?
The canonical SMILES for (2E,6E)-4-tert-butyl-2,6-bis[(3-fluorophenyl)methylidene]cyclohexan-1-one is CC(C)(C)C1C/C(=C\c2cccc(F)c2)C(=O)/C(=C/c2cccc(F)c2)C1.
What is the InChIKey of (2E,6E)-4-tert-butyl-2,6-bis[(3-fluorophenyl)methylidene]cyclohexan-1-one?
The InChIKey is LSYCOGKXLCOZAB-XOBNHNQQSA-N. The full InChI is InChI=1S/C24H24F2O/c1-24(2,3)20-14-18(10-16-6-4-8-21(25)12-16)23(27)19(15-20)11-17-7-5-9-22(26)13-17/h4-13,20H,14-15H2,1-3H3/b18-10+,19-11+.
What are the key properties of (2E,6E)-4-tert-butyl-2,6-bis[(3-fluorophenyl)methylidene]cyclohexan-1-one?
(2E,6E)-4-tert-butyl-2,6-bis[(3-fluorophenyl)methylidene]cyclohexan-1-one has a molecular weight of 366.45 g/mol, XLogP of 6.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,6E)-4-tert-butyl-2,6-bis[(3-fluorophenyl)methylidene]cyclohexan-1-one is sourced from PubChem (CID 6283777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).