C12H13ClN6O — CID 62840708
5-chloro-6-hydrazinyl-N-[(5-methylpyrazin-2-yl)methyl]pyridine-3-carboxamide (PubChem CID 62840708) has the molecular formula C12H13ClN6O and a molecular weight of 292.73 g/mol. Its IUPAC name is 5-chloro-6-hydrazinyl-N-[(5-methylpyrazin-2-yl)methyl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-hydrazinyl-N-[(5-methylpyrazin-2-yl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62840708 |
| Molecular Formula | C12H13ClN6O |
| Molecular Weight | 292.73 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 5-chloro-6-hydrazinyl-N-[(5-methylpyrazin-2-yl)methyl]pyridine-3-carboxamide |
| SMILES | Cc1cnc(CNC(=O)c2cnc(NN)c(Cl)c2)cn1 |
| InChI | InChI=1S/C12H13ClN6O/c1-7-3-16-9(5-15-7)6-18-12(20)8-2-10(13)11(19-14)17-4-8/h2-5H,6,14H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | RTOPMLGBZJPHGO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.73 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|