C16H19NOS — CID 62841470
2-[1-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)ethyl]phenol (PubChem CID 62841470) has the molecular formula C16H19NOS and a molecular weight of 273.40 g/mol. Its IUPAC name is 2-[1-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)ethyl]phenol.
| Compound Name | 2-[1-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)ethyl]phenol |
|---|---|
| PubChem CID | 62841470 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 2-[1-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)ethyl]phenol |
| SMILES | CC(NC1CCCc2sccc21)c1ccccc1O |
| InChI | InChI=1S/C16H19NOS/c1-11(12-5-2-3-7-15(12)18)17-14-6-4-8-16-13(14)9-10-19-16/h2-3,5,7,9-11,14,17-18H,4,6,8H2,1H3 |
| InChIKey | SQGRMDYHTWHHAR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|