9-fluoro-4,5-dihydrothieno[2,3-c]acridine-6-carboxylic acid

C16H10FNO2S — CID 62842113

IUPAC9-fluoro-4,5-dihydrothieno[2,3-c]acridine-6-carboxylic acid
SMILESO=C(O)c1c2c(nc3cc(F)ccc13)-c1ccsc1CC2
InChIInChI=1S/C16H10FNO2S/c17-8-1-2-9-12(7-8)18-15-10-5-6-21-13(10)4-3-11(15)14(9)16(19)20/h1-2,5-7H,3-4H2,(H,19,20)
InChIKeyVQUKLZWHJWJCAU-UHFFFAOYSA-N
MW299.33 g/mol
LogP3.90
Rot. Bonds1

About 9-fluoro-4,5-dihydrothieno[2,3-c]acridine-6-carboxylic acid

9-fluoro-4,5-dihydrothieno[2,3-c]acridine-6-carboxylic acid (PubChem CID 62842113) has the molecular formula C16H10FNO2S and a molecular weight of 299.33 g/mol. Its IUPAC name is 9-fluoro-4,5-dihydrothieno[2,3-c]acridine-6-carboxylic acid.

Molecular Properties

Compound Name9-fluoro-4,5-dihydrothieno[2,3-c]acridine-6-carboxylic acid
PubChem CID62842113
Molecular FormulaC16H10FNO2S
Molecular Weight299.33 g/mol
Exact Mass299.04
IUPAC Name9-fluoro-4,5-dihydrothieno[2,3-c]acridine-6-carboxylic acid
SMILESO=C(O)c1c2c(nc3cc(F)ccc13)-c1ccsc1CC2
InChIInChI=1S/C16H10FNO2S/c17-8-1-2-9-12(7-8)18-15-10-5-6-21-13(10)4-3-11(15)14(9)16(19)20/h1-2,5-7H,3-4H2,(H,19,20)
InChIKeyVQUKLZWHJWJCAU-UHFFFAOYSA-N
XLogP3.90
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500299.33
LogP ≤ 53.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 9-fluoro-4,5-dihydrothieno[2,3-c]acridine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9-fluoro-4,5-dihydrothieno[2,3-c]acridine-6-carboxylic acid?
The IUPAC name of 9-fluoro-4,5-dihydrothieno[2,3-c]acridine-6-carboxylic acid (CID 62842113) is 9-fluoro-4,5-dihydrothieno[2,3-c]acridine-6-carboxylic acid.
What is the SMILES notation for 9-fluoro-4,5-dihydrothieno[2,3-c]acridine-6-carboxylic acid?
The canonical SMILES for 9-fluoro-4,5-dihydrothieno[2,3-c]acridine-6-carboxylic acid is O=C(O)c1c2c(nc3cc(F)ccc13)-c1ccsc1CC2.
What is the InChIKey of 9-fluoro-4,5-dihydrothieno[2,3-c]acridine-6-carboxylic acid?
The InChIKey is VQUKLZWHJWJCAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10FNO2S/c17-8-1-2-9-12(7-8)18-15-10-5-6-21-13(10)4-3-11(15)14(9)16(19)20/h1-2,5-7H,3-4H2,(H,19,20).
What are the key properties of 9-fluoro-4,5-dihydrothieno[2,3-c]acridine-6-carboxylic acid?
9-fluoro-4,5-dihydrothieno[2,3-c]acridine-6-carboxylic acid has a molecular weight of 299.33 g/mol, XLogP of 3.90, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-fluoro-4,5-dihydrothieno[2,3-c]acridine-6-carboxylic acid is sourced from PubChem (CID 62842113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).