C10H21N3O — CID 62842933
3-[2-[2-methoxyethyl(methyl)amino]ethylamino]butanenitrile (PubChem CID 62842933) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is 3-[2-[2-methoxyethyl(methyl)amino]ethylamino]butanenitrile.
| Compound Name | 3-[2-[2-methoxyethyl(methyl)amino]ethylamino]butanenitrile |
|---|---|
| PubChem CID | 62842933 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 3-[2-[2-methoxyethyl(methyl)amino]ethylamino]butanenitrile |
| SMILES | COCCN(C)CCNC(C)CC#N |
| InChI | InChI=1S/C10H21N3O/c1-10(4-5-11)12-6-7-13(2)8-9-14-3/h10,12H,4,6-9H2,1-3H3 |
| InChIKey | DKRISFXCNVJODW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |