C10H23N3O2 — CID 62843100
3-[2-[2-methoxyethyl(methyl)amino]ethylamino]-2-methylpropanamide (PubChem CID 62843100) has the molecular formula C10H23N3O2 and a molecular weight of 217.31 g/mol. Its IUPAC name is 3-[2-[2-methoxyethyl(methyl)amino]ethylamino]-2-methylpropanamide.
| Compound Name | 3-[2-[2-methoxyethyl(methyl)amino]ethylamino]-2-methylpropanamide |
|---|---|
| PubChem CID | 62843100 |
| Molecular Formula | C10H23N3O2 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 3-[2-[2-methoxyethyl(methyl)amino]ethylamino]-2-methylpropanamide |
| SMILES | COCCN(C)CCNCC(C)C(N)=O |
| InChI | InChI=1S/C10H23N3O2/c1-9(10(11)14)8-12-4-5-13(2)6-7-15-3/h9,12H,4-8H2,1-3H3,(H2,11,14) |
| InChIKey | UYRJGVUKUKPECG-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|