C14H18N2O3S2 — CID 62844249
5-amino-2-ethoxy-N-(1-thiophen-3-ylethyl)benzenesulfonamide (PubChem CID 62844249) has the molecular formula C14H18N2O3S2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 5-amino-2-ethoxy-N-(1-thiophen-3-ylethyl)benzenesulfonamide.
| Compound Name | 5-amino-2-ethoxy-N-(1-thiophen-3-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 62844249 |
| Molecular Formula | C14H18N2O3S2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 5-amino-2-ethoxy-N-(1-thiophen-3-ylethyl)benzenesulfonamide |
| SMILES | CCOc1ccc(N)cc1S(=O)(=O)NC(C)c1ccsc1 |
| InChI | InChI=1S/C14H18N2O3S2/c1-3-19-13-5-4-12(15)8-14(13)21(17,18)16-10(2)11-6-7-20-9-11/h4-10,16H,3,15H2,1-2H3 |
| InChIKey | KPEGNYOVDVDNGP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|