C14H12N2OS3 — CID 62844380
2-sulfanylidene-3-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-1H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 62844380) has the molecular formula C14H12N2OS3 and a molecular weight of 320.46 g/mol. Its IUPAC name is 2-sulfanylidene-3-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-1H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-sulfanylidene-3-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-1H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 62844380 |
| Molecular Formula | C14H12N2OS3 |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 2-sulfanylidene-3-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-1H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2sccc2[nH]c(=S)n1C1CCCc2sccc21 |
| InChI | InChI=1S/C14H12N2OS3/c17-13-12-9(5-7-20-12)15-14(18)16(13)10-2-1-3-11-8(10)4-6-19-11/h4-7,10H,1-3H2,(H,15,18) |
| InChIKey | LHACBXMCLUVDEG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|